C22H21FN2O6 — CID 91046505
carbamoyl 5-ethoxy-2-(4-fluorophenyl)-6-morpholin-4-yl-1-benzofuran-3-carboxylate (PubChem CID 91046505) has the molecular formula C22H21FN2O6 and a molecular weight of 428.42 g/mol. Its IUPAC name is carbamoyl 5-ethoxy-2-(4-fluorophenyl)-6-morpholin-4-yl-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 5-ethoxy-2-(4-fluorophenyl)-6-morpholin-4-yl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91046505 |
| Molecular Formula | C22H21FN2O6 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | carbamoyl 5-ethoxy-2-(4-fluorophenyl)-6-morpholin-4-yl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1N1CCOCC1 |
| InChI | InChI=1S/C22H21FN2O6/c1-2-29-18-11-15-17(12-16(18)25-7-9-28-10-8-25)30-20(13-3-5-14(23)6-4-13)19(15)21(26)31-22(24)27/h3-6,11-12H,2,7-10H2,1H3,(H2,24,27) |
| InChIKey | SGCZPJMVHJKUSB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|