C23H25FN2O5 — CID 10048210
2-(4-fluorophenyl)-5-(2-methoxyethoxy)-N-methyl-6-morpholin-4-yl-1-benzofuran-3-carboxamide (PubChem CID 10048210) has the molecular formula C23H25FN2O5 and a molecular weight of 428.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(2-methoxyethoxy)-N-methyl-6-morpholin-4-yl-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-(2-methoxyethoxy)-N-methyl-6-morpholin-4-yl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 10048210 |
| Molecular Formula | C23H25FN2O5 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(2-methoxyethoxy)-N-methyl-6-morpholin-4-yl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N3CCOCC3)c(OCCOC)cc12 |
| InChI | InChI=1S/C23H25FN2O5/c1-25-23(27)21-17-13-20(30-12-11-28-2)18(26-7-9-29-10-8-26)14-19(17)31-22(21)15-3-5-16(24)6-4-15/h3-6,13-14H,7-12H2,1-2H3,(H,25,27) |
| InChIKey | PVEJHYYXBAMUHJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|