C22H22FNO6 — CID 142773423
2-(4-fluorophenyl)-5-(2-hydroxypropoxy)-6-morpholin-4-yl-1-benzofuran-3-carboxylic acid (PubChem CID 142773423) has the molecular formula C22H22FNO6 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(2-hydroxypropoxy)-6-morpholin-4-yl-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-(4-fluorophenyl)-5-(2-hydroxypropoxy)-6-morpholin-4-yl-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 142773423 |
| Molecular Formula | C22H22FNO6 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(2-hydroxypropoxy)-6-morpholin-4-yl-1-benzofuran-3-carboxylic acid |
| SMILES | CC(O)COc1cc2c(C(=O)O)c(-c3ccc(F)cc3)oc2cc1N1CCOCC1 |
| InChI | InChI=1S/C22H22FNO6/c1-13(25)12-29-19-10-16-18(11-17(19)24-6-8-28-9-7-24)30-21(20(16)22(26)27)14-2-4-15(23)5-3-14/h2-5,10-11,13,25H,6-9,12H2,1H3,(H,26,27) |
| InChIKey | PPUPHAHVSBEINE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |