C17H11ClFNO5 — CID 91485530
carbamoyl 6-chloro-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate (PubChem CID 91485530) has the molecular formula C17H11ClFNO5 and a molecular weight of 363.73 g/mol. Its IUPAC name is carbamoyl 6-chloro-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 6-chloro-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91485530 |
| Molecular Formula | C17H11ClFNO5 |
| Molecular Weight | 363.73 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | carbamoyl 6-chloro-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate |
| SMILES | COc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1Cl |
| InChI | InChI=1S/C17H11ClFNO5/c1-23-13-6-10-12(7-11(13)18)24-15(8-2-4-9(19)5-3-8)14(10)16(21)25-17(20)22/h2-7H,1H3,(H2,20,22) |
| InChIKey | RGTXFPDYGHNPRY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|