C22H17FN2O7 — CID 91201724
carbamoyl 2-(4-fluorophenyl)-6-[4-(2-hydroxyethyl)-1,2-oxazol-3-yl]-5-methoxy-1-benzofuran-3-carboxylate (PubChem CID 91201724) has the molecular formula C22H17FN2O7 and a molecular weight of 440.38 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-6-[4-(2-hydroxyethyl)-1,2-oxazol-3-yl]-5-methoxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-6-[4-(2-hydroxyethyl)-1,2-oxazol-3-yl]-5-methoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91201724 |
| Molecular Formula | C22H17FN2O7 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-6-[4-(2-hydroxyethyl)-1,2-oxazol-3-yl]-5-methoxy-1-benzofuran-3-carboxylate |
| SMILES | COc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1-c1nocc1CCO |
| InChI | InChI=1S/C22H17FN2O7/c1-29-16-8-14-17(9-15(16)19-12(6-7-26)10-30-25-19)31-20(11-2-4-13(23)5-3-11)18(14)21(27)32-22(24)28/h2-5,8-10,26H,6-7H2,1H3,(H2,24,28) |
| InChIKey | LTIRGXGJHPOLPY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|