C34H33FN4O3S — CID 123442776
N-[4-(benzimidazol-1-yl)butyl]-N-[2-(4-fluorophenyl)-3-(methylaminomethyl)-5-phenyl-1-benzofuran-6-yl]methanesulfonamide (PubChem CID 123442776) has the molecular formula C34H33FN4O3S and a molecular weight of 596.73 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)butyl]-N-[2-(4-fluorophenyl)-3-(methylaminomethyl)-5-phenyl-1-benzofuran-6-yl]methanesulfonamide.
| Compound Name | N-[4-(benzimidazol-1-yl)butyl]-N-[2-(4-fluorophenyl)-3-(methylaminomethyl)-5-phenyl-1-benzofuran-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 123442776 |
| Molecular Formula | C34H33FN4O3S |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)butyl]-N-[2-(4-fluorophenyl)-3-(methylaminomethyl)-5-phenyl-1-benzofuran-6-yl]methanesulfonamide |
| SMILES | CNCc1c(-c2ccc(F)cc2)oc2cc(N(CCCCn3cnc4ccccc43)S(C)(=O)=O)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C34H33FN4O3S/c1-36-22-29-28-20-27(24-10-4-3-5-11-24)32(21-33(28)42-34(29)25-14-16-26(35)17-15-25)39(43(2,40)41)19-9-8-18-38-23-37-30-12-6-7-13-31(30)38/h3-7,10-17,20-21,23,36H,8-9,18-19,22H2,1-2H3 |
| InChIKey | QRRJCSLAJPULMC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|