C35H34N4O4S — CID 159106386
6-[4-(benzimidazol-1-yl)butyl-methylsulfonylamino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide (PubChem CID 159106386) has the molecular formula C35H34N4O4S and a molecular weight of 606.75 g/mol. Its IUPAC name is 6-[4-(benzimidazol-1-yl)butyl-methylsulfonylamino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-[4-(benzimidazol-1-yl)butyl-methylsulfonylamino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 159106386 |
| Molecular Formula | C35H34N4O4S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 6-[4-(benzimidazol-1-yl)butyl-methylsulfonylamino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2cc(N(CCCCn3cnc4ccccc43)S(C)(=O)=O)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C35H34N4O4S/c1-24-15-17-26(18-16-24)34-33(35(40)36-2)28-21-27(25-11-5-4-6-12-25)31(22-32(28)43-34)39(44(3,41)42)20-10-9-19-38-23-37-29-13-7-8-14-30(29)38/h4-8,11-18,21-23H,9-10,19-20H2,1-3H3,(H,36,40) |
| InChIKey | NBTJTRFTIQAKRW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|