C30H30N2O4S — CID 159839290
6-[cyclohex-2-en-1-yl(methylsulfonyl)amino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide (PubChem CID 159839290) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 6-[cyclohex-2-en-1-yl(methylsulfonyl)amino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-[cyclohex-2-en-1-yl(methylsulfonyl)amino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 159839290 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 6-[cyclohex-2-en-1-yl(methylsulfonyl)amino]-N-methyl-2-(4-methylphenyl)-5-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2cc(N(C3C=CCCC3)S(C)(=O)=O)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C30H30N2O4S/c1-20-14-16-22(17-15-20)29-28(30(33)31-2)25-18-24(21-10-6-4-7-11-21)26(19-27(25)36-29)32(37(3,34)35)23-12-8-5-9-13-23/h4,6-8,10-12,14-19,23H,5,9,13H2,1-3H3,(H,31,33) |
| InChIKey | PJVLSAABBBGVTR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|