C17H15NO2 — CID 10333083
N,5-dimethyl-2-phenyl-1-benzofuran-3-carboxamide (PubChem CID 10333083) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is N,5-dimethyl-2-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | N,5-dimethyl-2-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 10333083 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N,5-dimethyl-2-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccccc2)oc2ccc(C)cc12 |
| InChI | InChI=1S/C17H15NO2/c1-11-8-9-14-13(10-11)15(17(19)18-2)16(20-14)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,18,19) |
| InChIKey | NIDWBSRDQRZUNK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |