C27H35N3O4S — CID 122472614
5-cyclopropyl-2-(4-ethylphenyl)-6-(hexylsulfamoylmethyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide (PubChem CID 122472614) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-ethylphenyl)-6-(hexylsulfamoylmethyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-cyclopropyl-2-(4-ethylphenyl)-6-(hexylsulfamoylmethyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122472614 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 5-cyclopropyl-2-(4-ethylphenyl)-6-(hexylsulfamoylmethyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide |
| SMILES | CCCCCCNS(=O)(=O)Cc1nc2oc(-c3ccc(CC)cc3)c(C(=O)NC)c2cc1C1CC1 |
| InChI | InChI=1S/C27H35N3O4S/c1-4-6-7-8-15-29-35(32,33)17-23-21(19-13-14-19)16-22-24(26(31)28-3)25(34-27(22)30-23)20-11-9-18(5-2)10-12-20/h9-12,16,19,29H,4-8,13-15,17H2,1-3H3,(H,28,31) |
| InChIKey | MWZYIZQBESKGMK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|