C31H39N3O8S — CID 122472687
6-[[4-(4-carboxyoxyoxan-4-yl)butyl-sulfinoamino]methyl]-5-cyclopropyl-2-(4-ethylphenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine (PubChem CID 122472687) has the molecular formula C31H39N3O8S and a molecular weight of 613.73 g/mol. Its IUPAC name is 6-[[4-(4-carboxyoxyoxan-4-yl)butyl-sulfinoamino]methyl]-5-cyclopropyl-2-(4-ethylphenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine.
| Compound Name | 6-[[4-(4-carboxyoxyoxan-4-yl)butyl-sulfinoamino]methyl]-5-cyclopropyl-2-(4-ethylphenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 122472687 |
| Molecular Formula | C31H39N3O8S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 6-[[4-(4-carboxyoxyoxan-4-yl)butyl-sulfinoamino]methyl]-5-cyclopropyl-2-(4-ethylphenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridine |
| SMILES | CCc1ccc(-c2oc3nc(CN(CCCCC4(OC(=O)O)CCOCC4)S(=O)O)c(C4CC4)cc3c2C(=O)NC)cc1 |
| InChI | InChI=1S/C31H39N3O8S/c1-3-20-6-8-22(9-7-20)27-26(28(35)32-2)24-18-23(21-10-11-21)25(33-29(24)41-27)19-34(43(38)39)15-5-4-12-31(42-30(36)37)13-16-40-17-14-31/h6-9,18,21H,3-5,10-17,19H2,1-2H3,(H,32,35)(H,36,37)(H,38,39) |
| InChIKey | KSKOCVLQERBTOT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 151.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|