C25H28FN3O6S — CID 66663483
5-cyclopropyl-2-(4-fluorophenyl)-6-[[(5-methoxy-5-oxopentyl)-sulfinoamino]methyl]-3-(methylcarbamoyl)furo[2,3-b]pyridine (PubChem CID 66663483) has the molecular formula C25H28FN3O6S and a molecular weight of 517.58 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-6-[[(5-methoxy-5-oxopentyl)-sulfinoamino]methyl]-3-(methylcarbamoyl)furo[2,3-b]pyridine.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[[(5-methoxy-5-oxopentyl)-sulfinoamino]methyl]-3-(methylcarbamoyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 66663483 |
| Molecular Formula | C25H28FN3O6S |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[[(5-methoxy-5-oxopentyl)-sulfinoamino]methyl]-3-(methylcarbamoyl)furo[2,3-b]pyridine |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CN(CCCCC(=O)OC)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C25H28FN3O6S/c1-27-24(31)22-19-13-18(15-6-7-15)20(14-29(36(32)33)12-4-3-5-21(30)34-2)28-25(19)35-23(22)16-8-10-17(26)11-9-16/h8-11,13,15H,3-7,12,14H2,1-2H3,(H,27,31)(H,32,33) |
| InChIKey | WQGAOKXDCMEHAZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|