C26H33N3O4S — CID 71065812
5-cyclopropyl-6-[[hexyl(sulfino)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine (PubChem CID 71065812) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 5-cyclopropyl-6-[[hexyl(sulfino)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine.
| Compound Name | 5-cyclopropyl-6-[[hexyl(sulfino)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71065812 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 5-cyclopropyl-6-[[hexyl(sulfino)amino]methyl]-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
| SMILES | CCCCCCN(Cc1nc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1C1CC1)S(=O)O |
| InChI | InChI=1S/C26H33N3O4S/c1-4-5-6-7-14-29(34(31)32)16-22-20(18-12-13-18)15-21-23(25(30)27-3)24(33-26(21)28-22)19-10-8-17(2)9-11-19/h8-11,15,18H,4-7,12-14,16H2,1-3H3,(H,27,30)(H,31,32) |
| InChIKey | YLLGQINLPMASMJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|