C28H32N3O7S- — CID 123173472
6-[[(5-carboxy-6-oxoheptyl)-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine (PubChem CID 123173472) has the molecular formula C28H32N3O7S- and a molecular weight of 554.65 g/mol. Its IUPAC name is 6-[[(5-carboxy-6-oxoheptyl)-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine.
| Compound Name | 6-[[(5-carboxy-6-oxoheptyl)-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123173472 |
| Molecular Formula | C28H32N3O7S- |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 6-[[(5-carboxy-6-oxoheptyl)-sulfinatoamino]methyl]-5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)furo[2,3-b]pyridine |
| SMILES | CNC(=O)c1c(-c2ccc(C)cc2)oc2nc(CN(CCCCC(C(C)=O)C(=O)O)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C28H33N3O7S/c1-16-7-9-19(10-8-16)25-24(26(33)29-3)22-14-21(18-11-12-18)23(30-27(22)38-25)15-31(39(36)37)13-5-4-6-20(17(2)32)28(34)35/h7-10,14,18,20H,4-6,11-13,15H2,1-3H3,(H,29,33)(H,34,35)(H,36,37)/p-1 |
| InChIKey | FHUGARYWWOWTHE-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|