C23H28BrN3O4S — CID 123163715
N-(3-bromopropyl)-N-[5-cyclopropyl-3-[hydroxy(methylamino)methyl]-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methanesulfonamide (PubChem CID 123163715) has the molecular formula C23H28BrN3O4S and a molecular weight of 522.47 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-[5-cyclopropyl-3-[hydroxy(methylamino)methyl]-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methanesulfonamide.
| Compound Name | N-(3-bromopropyl)-N-[5-cyclopropyl-3-[hydroxy(methylamino)methyl]-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 123163715 |
| Molecular Formula | C23H28BrN3O4S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | N-(3-bromopropyl)-N-[5-cyclopropyl-3-[hydroxy(methylamino)methyl]-2-(4-methylphenyl)furo[2,3-b]pyridin-6-yl]methanesulfonamide |
| SMILES | CNC(O)c1c(-c2ccc(C)cc2)oc2nc(N(CCCBr)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C23H28BrN3O4S/c1-14-5-7-16(8-6-14)20-19(22(28)25-2)18-13-17(15-9-10-15)21(26-23(18)31-20)27(12-4-11-24)32(3,29)30/h5-8,13,15,22,25,28H,4,9-12H2,1-3H3 |
| InChIKey | PVPNFXJVCSCMSH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|