C21H23FIN3O6S2 — CID 123526694
2-(4-fluorophenyl)-5-(iodomethyl)-6-[methylsulfonyl(4-methylsulfonylbutyl)amino]furo[2,3-b]pyridine-3-carboxamide (PubChem CID 123526694) has the molecular formula C21H23FIN3O6S2 and a molecular weight of 623.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(iodomethyl)-6-[methylsulfonyl(4-methylsulfonylbutyl)amino]furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-(iodomethyl)-6-[methylsulfonyl(4-methylsulfonylbutyl)amino]furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123526694 |
| Molecular Formula | C21H23FIN3O6S2 |
| Molecular Weight | 623.47 g/mol |
| Exact Mass | 623.01 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(iodomethyl)-6-[methylsulfonyl(4-methylsulfonylbutyl)amino]furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)CCCCN(c1nc2oc(-c3ccc(F)cc3)c(C(N)=O)c2cc1CI)S(C)(=O)=O |
| InChI | InChI=1S/C21H23FIN3O6S2/c1-33(28,29)10-4-3-9-26(34(2,30)31)20-14(12-23)11-16-17(19(24)27)18(32-21(16)25-20)13-5-7-15(22)8-6-13/h5-8,11H,3-4,9-10,12H2,1-2H3,(H2,24,27) |
| InChIKey | MENBUDAWEYBTCR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|