C20H19FIN3O4S — CID 123670297
6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-(iodomethyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 123670297) has the molecular formula C20H19FIN3O4S and a molecular weight of 543.36 g/mol. Its IUPAC name is 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-(iodomethyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-(iodomethyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123670297 |
| Molecular Formula | C20H19FIN3O4S |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | 6-[but-3-enyl(methylsulfonyl)amino]-2-(4-fluorophenyl)-5-(iodomethyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | C=CCCN(c1nc2oc(-c3ccc(F)cc3)c(C(N)=O)c2cc1CI)S(C)(=O)=O |
| InChI | InChI=1S/C20H19FIN3O4S/c1-3-4-9-25(30(2,27)28)19-13(11-22)10-15-16(18(23)26)17(29-20(15)24-19)12-5-7-14(21)8-6-12/h3,5-8,10H,1,4,9,11H2,2H3,(H2,23,26) |
| InChIKey | WIONKALNLLRWMX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|