C19H18FIN2O3S — CID 141318375
N-[2-(4-fluorophenyl)-5-iodofuro[2,3-b]pyridin-6-yl]-N-pent-4-enylmethanesulfonamide (PubChem CID 141318375) has the molecular formula C19H18FIN2O3S and a molecular weight of 500.33 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-5-iodofuro[2,3-b]pyridin-6-yl]-N-pent-4-enylmethanesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-5-iodofuro[2,3-b]pyridin-6-yl]-N-pent-4-enylmethanesulfonamide |
|---|---|
| PubChem CID | 141318375 |
| Molecular Formula | C19H18FIN2O3S |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | N-[2-(4-fluorophenyl)-5-iodofuro[2,3-b]pyridin-6-yl]-N-pent-4-enylmethanesulfonamide |
| SMILES | C=CCCCN(c1nc2oc(-c3ccc(F)cc3)cc2cc1I)S(C)(=O)=O |
| InChI | InChI=1S/C19H18FIN2O3S/c1-3-4-5-10-23(27(2,24)25)18-16(21)11-14-12-17(26-19(14)22-18)13-6-8-15(20)9-7-13/h3,6-9,11-12H,1,4-5,10H2,2H3 |
| InChIKey | CPTCOZKCUJEROJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|