C24H21FIN5O8S2 — CID 66663625
2-(4-fluorophenyl)-5-iodo-N-methyl-6-[methylsulfonyl-[2-[(2-nitrophenyl)sulfonylamino]ethyl]amino]furo[2,3-b]pyridine-3-carboxamide (PubChem CID 66663625) has the molecular formula C24H21FIN5O8S2 and a molecular weight of 717.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-iodo-N-methyl-6-[methylsulfonyl-[2-[(2-nitrophenyl)sulfonylamino]ethyl]amino]furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-iodo-N-methyl-6-[methylsulfonyl-[2-[(2-nitrophenyl)sulfonylamino]ethyl]amino]furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66663625 |
| Molecular Formula | C24H21FIN5O8S2 |
| Molecular Weight | 717.50 g/mol |
| Exact Mass | 716.99 |
| IUPAC Name | 2-(4-fluorophenyl)-5-iodo-N-methyl-6-[methylsulfonyl-[2-[(2-nitrophenyl)sulfonylamino]ethyl]amino]furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(N(CCNS(=O)(=O)c3ccccc3[N+](=O)[O-])S(C)(=O)=O)c(I)cc12 |
| InChI | InChI=1S/C24H21FIN5O8S2/c1-27-23(32)20-16-13-17(26)22(29-24(16)39-21(20)14-7-9-15(25)10-8-14)30(40(2,35)36)12-11-28-41(37,38)19-6-4-3-5-18(19)31(33)34/h3-10,13,28H,11-12H2,1-2H3,(H,27,32) |
| InChIKey | PBKJGUHWSCVOJX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|