C20H19FIN3O8S2 — CID 123342774
carbamoyl 2-(4-fluorophenyl)-5-iodo-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate (PubChem CID 123342774) has the molecular formula C20H19FIN3O8S2 and a molecular weight of 639.42 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-5-iodo-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-5-iodo-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 123342774 |
| Molecular Formula | C20H19FIN3O8S2 |
| Molecular Weight | 639.42 g/mol |
| Exact Mass | 638.96 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-5-iodo-6-[methylsulfonyl(3-methylsulfonylpropyl)amino]furo[2,3-b]pyridine-3-carboxylate |
| SMILES | CS(=O)(=O)CCCN(c1nc2oc(-c3ccc(F)cc3)c(C(=O)OC(N)=O)c2cc1I)S(C)(=O)=O |
| InChI | InChI=1S/C20H19FIN3O8S2/c1-34(28,29)9-3-8-25(35(2,30)31)17-14(22)10-13-15(19(26)33-20(23)27)16(32-18(13)24-17)11-4-6-12(21)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H2,23,27) |
| InChIKey | ALPMXCFTZBRVLF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|