C28H27FN4O5S — CID 123781471
6-[3-(2-cyanophenoxy)propyl-methylsulfonylamino]-5-ethyl-2-[(4-fluorophenyl)methyl]furo[2,3-b]pyridine-3-carboxamide (PubChem CID 123781471) has the molecular formula C28H27FN4O5S and a molecular weight of 550.61 g/mol. Its IUPAC name is 6-[3-(2-cyanophenoxy)propyl-methylsulfonylamino]-5-ethyl-2-[(4-fluorophenyl)methyl]furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-[3-(2-cyanophenoxy)propyl-methylsulfonylamino]-5-ethyl-2-[(4-fluorophenyl)methyl]furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123781471 |
| Molecular Formula | C28H27FN4O5S |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 6-[3-(2-cyanophenoxy)propyl-methylsulfonylamino]-5-ethyl-2-[(4-fluorophenyl)methyl]furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCc1cc2c(C(N)=O)c(Cc3ccc(F)cc3)oc2nc1N(CCCOc1ccccc1C#N)S(C)(=O)=O |
| InChI | InChI=1S/C28H27FN4O5S/c1-3-19-16-22-25(26(31)34)24(15-18-9-11-21(29)12-10-18)38-28(22)32-27(19)33(39(2,35)36)13-6-14-37-23-8-5-4-7-20(23)17-30/h4-5,7-12,16H,3,6,13-15H2,1-2H3,(H2,31,34) |
| InChIKey | YAOHXECPFNHTDA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|