C18H12F5NO5S — CID 118684753
[4-fluoro-2-(4-fluorophenyl)-6-methyl-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate (PubChem CID 118684753) has the molecular formula C18H12F5NO5S and a molecular weight of 449.35 g/mol. Its IUPAC name is [4-fluoro-2-(4-fluorophenyl)-6-methyl-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate.
| Compound Name | [4-fluoro-2-(4-fluorophenyl)-6-methyl-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118684753 |
| Molecular Formula | C18H12F5NO5S |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | [4-fluoro-2-(4-fluorophenyl)-6-methyl-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(C)c(OS(=O)(=O)C(F)(F)F)c(F)c12 |
| InChI | InChI=1S/C18H12F5NO5S/c1-8-7-11-12(14(20)15(8)29-30(26,27)18(21,22)23)13(17(25)24-2)16(28-11)9-3-5-10(19)6-4-9/h3-7H,1-2H3,(H,24,25) |
| InChIKey | NIDNSGGDTVHVRR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|