C25H19F2NO3 — CID 143956952
4-fluoro-2-(4-fluorophenyl)-5-(5-formyl-2,4-dimethylphenyl)-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 143956952) has the molecular formula C25H19F2NO3 and a molecular weight of 419.43 g/mol. Its IUPAC name is 4-fluoro-2-(4-fluorophenyl)-5-(5-formyl-2,4-dimethylphenyl)-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 4-fluoro-2-(4-fluorophenyl)-5-(5-formyl-2,4-dimethylphenyl)-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 143956952 |
| Molecular Formula | C25H19F2NO3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-fluoro-2-(4-fluorophenyl)-5-(5-formyl-2,4-dimethylphenyl)-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cc(C=O)c(C)cc3C)c(F)c12 |
| InChI | InChI=1S/C25H19F2NO3/c1-13-10-14(2)19(11-16(13)12-29)18-8-9-20-21(23(18)27)22(25(30)28-3)24(31-20)15-4-6-17(26)7-5-15/h4-12H,1-3H3,(H,28,30) |
| InChIKey | JKHSXLSLSYUFJS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|