C28H25FN2O3 — CID 135267585
1-ethyl-6-(4-fluorophenyl)-10-(3-formylphenyl)-N,4-dimethyloxonino[4,3-b]pyrrole-7-carboxamide (PubChem CID 135267585) has the molecular formula C28H25FN2O3 and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-ethyl-6-(4-fluorophenyl)-10-(3-formylphenyl)-N,4-dimethyloxonino[4,3-b]pyrrole-7-carboxamide.
| Compound Name | 1-ethyl-6-(4-fluorophenyl)-10-(3-formylphenyl)-N,4-dimethyloxonino[4,3-b]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 135267585 |
| Molecular Formula | C28H25FN2O3 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-ethyl-6-(4-fluorophenyl)-10-(3-formylphenyl)-N,4-dimethyloxonino[4,3-b]pyrrole-7-carboxamide |
| SMILES | CCn1ccc2c(C)oc(-c3ccc(F)cc3)c(C(=O)NC)ccc(-c3cccc(C=O)c3)c21 |
| InChI | InChI=1S/C28H25FN2O3/c1-4-31-15-14-23-18(2)34-27(20-8-10-22(29)11-9-20)25(28(33)30-3)13-12-24(26(23)31)21-7-5-6-19(16-21)17-32/h5-17H,4H2,1-3H3,(H,30,33)/b13-12-,23-18-,26-24-,27-25+ |
| InChIKey | XHWUCEASPYLAIG-DRGSDPTFSA-N |
| XLogP | 6.33 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|