C30H28F4N4O4 — CID 162570596
5-[3-(2-cyanopropan-2-ylcarbamoyl)-4-methoxyphenyl]-2-(4-fluorocyclohexa-1,3-dien-1-yl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 162570596) has the molecular formula C30H28F4N4O4 and a molecular weight of 584.57 g/mol. Its IUPAC name is 5-[3-(2-cyanopropan-2-ylcarbamoyl)-4-methoxyphenyl]-2-(4-fluorocyclohexa-1,3-dien-1-yl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-[3-(2-cyanopropan-2-ylcarbamoyl)-4-methoxyphenyl]-2-(4-fluorocyclohexa-1,3-dien-1-yl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162570596 |
| Molecular Formula | C30H28F4N4O4 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 5-[3-(2-cyanopropan-2-ylcarbamoyl)-4-methoxyphenyl]-2-(4-fluorocyclohexa-1,3-dien-1-yl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(C2=CC=C(F)CC2)oc2nc(CCC(F)(F)F)c(-c3ccc(OC)c(C(=O)NC(C)(C)C#N)c3)cc12 |
| InChI | InChI=1S/C30H28F4N4O4/c1-29(2,15-35)38-26(39)20-13-17(7-10-23(20)41-4)19-14-21-24(27(40)36-3)25(16-5-8-18(31)9-6-16)42-28(21)37-22(19)11-12-30(32,33)34/h5,7-8,10,13-14H,6,9,11-12H2,1-4H3,(H,36,40)(H,38,39) |
| InChIKey | RRJGHOBZFWMKDP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |