C21H26N2O3 — CID 118392135
benzyl 1-(4-acetyl-4-methylcyclohexyl)-5-methylpyrazole-4-carboxylate (PubChem CID 118392135) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is benzyl 1-(4-acetyl-4-methylcyclohexyl)-5-methylpyrazole-4-carboxylate.
| Compound Name | benzyl 1-(4-acetyl-4-methylcyclohexyl)-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 118392135 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | benzyl 1-(4-acetyl-4-methylcyclohexyl)-5-methylpyrazole-4-carboxylate |
| SMILES | CC(=O)C1(C)CCC(n2ncc(C(=O)OCc3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C21H26N2O3/c1-15-19(20(25)26-14-17-7-5-4-6-8-17)13-22-23(15)18-9-11-21(3,12-10-18)16(2)24/h4-8,13,18H,9-12,14H2,1-3H3 |
| InChIKey | LJBBHHFOMAYINF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |