benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate

C25H27NO2 — CID 101492956

IUPACbenzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate
SMILESCc1c(C(=O)OCc2ccccc2)c(-c2ccccc2)cn1C1CCCCC1
InChIInChI=1S/C25H27NO2/c1-19-24(25(27)28-18-20-11-5-2-6-12-20)23(21-13-7-3-8-14-21)17-26(19)22-15-9-4-10-16-22/h2-3,5-8,11-14,17,22H,4,9-10,15-16,18H2,1H3
InChIKeyHNBLRAZEGBIDIF-UHFFFAOYSA-N
MW373.50 g/mol
LogP6.33
Rot. Bonds5

About benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate

benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate (PubChem CID 101492956) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate.

Molecular Properties

Compound Namebenzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate
PubChem CID101492956
Molecular FormulaC25H27NO2
Molecular Weight373.50 g/mol
Exact Mass373.20
IUPAC Namebenzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate
SMILESCc1c(C(=O)OCc2ccccc2)c(-c2ccccc2)cn1C1CCCCC1
InChIInChI=1S/C25H27NO2/c1-19-24(25(27)28-18-20-11-5-2-6-12-20)23(21-13-7-3-8-14-21)17-26(19)22-15-9-4-10-16-22/h2-3,5-8,11-14,17,22H,4,9-10,15-16,18H2,1H3
InChIKeyHNBLRAZEGBIDIF-UHFFFAOYSA-N
XLogP6.33
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500373.50
LogP ≤ 56.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate?
The IUPAC name of benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate (CID 101492956) is benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate.
What is the SMILES notation for benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate?
The canonical SMILES for benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate is Cc1c(C(=O)OCc2ccccc2)c(-c2ccccc2)cn1C1CCCCC1.
What is the InChIKey of benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate?
The InChIKey is HNBLRAZEGBIDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO2/c1-19-24(25(27)28-18-20-11-5-2-6-12-20)23(21-13-7-3-8-14-21)17-26(19)22-15-9-4-10-16-22/h2-3,5-8,11-14,17,22H,4,9-10,15-16,18H2,1H3.
What are the key properties of benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate?
benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate has a molecular weight of 373.50 g/mol, XLogP of 6.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-cyclohexyl-2-methyl-4-phenylpyrrole-3-carboxylate is sourced from PubChem (CID 101492956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).