benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate

C24H26N2O2 — CID 134951291

IUPACbenzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate
SMILESCc1c(C(=O)OCc2ccccc2)c(C2CCCCC2)nn1-c1ccccc1
InChIInChI=1S/C24H26N2O2/c1-18-22(24(27)28-17-19-11-5-2-6-12-19)23(20-13-7-3-8-14-20)25-26(18)21-15-9-4-10-16-21/h2,4-6,9-12,15-16,20H,3,7-8,13-14,17H2,1H3
InChIKeyUTCSPXTZBUHSSZ-UHFFFAOYSA-N
MW374.48 g/mol
LogP5.59
Rot. Bonds5

About benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate

benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 134951291) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate.

Molecular Properties

Compound Namebenzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate
PubChem CID134951291
Molecular FormulaC24H26N2O2
Molecular Weight374.48 g/mol
Exact Mass374.20
IUPAC Namebenzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate
SMILESCc1c(C(=O)OCc2ccccc2)c(C2CCCCC2)nn1-c1ccccc1
InChIInChI=1S/C24H26N2O2/c1-18-22(24(27)28-17-19-11-5-2-6-12-19)23(20-13-7-3-8-14-20)25-26(18)21-15-9-4-10-16-21/h2,4-6,9-12,15-16,20H,3,7-8,13-14,17H2,1H3
InChIKeyUTCSPXTZBUHSSZ-UHFFFAOYSA-N
XLogP5.59
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms28
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500374.48
LogP ≤ 55.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate?
The IUPAC name of benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate (CID 134951291) is benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate?
The canonical SMILES for benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate is Cc1c(C(=O)OCc2ccccc2)c(C2CCCCC2)nn1-c1ccccc1.
What is the InChIKey of benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate?
The InChIKey is UTCSPXTZBUHSSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2/c1-18-22(24(27)28-17-19-11-5-2-6-12-19)23(20-13-7-3-8-14-20)25-26(18)21-15-9-4-10-16-21/h2,4-6,9-12,15-16,20H,3,7-8,13-14,17H2,1H3.
What are the key properties of benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate?
benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate has a molecular weight of 374.48 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 134951291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).