C24H26N2O2 — CID 134951291
benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 134951291) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134951291 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | benzyl 3-cyclohexyl-5-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCc2ccccc2)c(C2CCCCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2/c1-18-22(24(27)28-17-19-11-5-2-6-12-19)23(20-13-7-3-8-14-20)25-26(18)21-15-9-4-10-16-21/h2,4-6,9-12,15-16,20H,3,7-8,13-14,17H2,1H3 |
| InChIKey | UTCSPXTZBUHSSZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |