C28H27ClF2N4O5 — CID 118392243
1-(4-acetylcyclohexyl)-N-[2-(2-chloro-6-nitrophenyl)-2-oxoethyl]-N-[(3,5-difluorophenyl)methyl]-5-methylpyrazole-4-carboxamide (PubChem CID 118392243) has the molecular formula C28H27ClF2N4O5 and a molecular weight of 573.00 g/mol. Its IUPAC name is 1-(4-acetylcyclohexyl)-N-[2-(2-chloro-6-nitrophenyl)-2-oxoethyl]-N-[(3,5-difluorophenyl)methyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-acetylcyclohexyl)-N-[2-(2-chloro-6-nitrophenyl)-2-oxoethyl]-N-[(3,5-difluorophenyl)methyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118392243 |
| Molecular Formula | C28H27ClF2N4O5 |
| Molecular Weight | 573.00 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 1-(4-acetylcyclohexyl)-N-[2-(2-chloro-6-nitrophenyl)-2-oxoethyl]-N-[(3,5-difluorophenyl)methyl]-5-methylpyrazole-4-carboxamide |
| SMILES | CC(=O)C1CCC(n2ncc(C(=O)N(CC(=O)c3c(Cl)cccc3[N+](=O)[O-])Cc3cc(F)cc(F)c3)c2C)CC1 |
| InChI | InChI=1S/C28H27ClF2N4O5/c1-16-23(13-32-34(16)22-8-6-19(7-9-22)17(2)36)28(38)33(14-18-10-20(30)12-21(31)11-18)15-26(37)27-24(29)4-3-5-25(27)35(39)40/h3-5,10-13,19,22H,6-9,14-15H2,1-2H3 |
| InChIKey | PSNHEVRFHQFFAK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.00 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|