C22H18ClNO3S — CID 11839351
[3-(2-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone (PubChem CID 11839351) has the molecular formula C22H18ClNO3S and a molecular weight of 411.91 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone.
| Compound Name | [3-(2-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11839351 |
| Molecular Formula | C22H18ClNO3S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [3-(2-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C(=O)c3ccccc3)C2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO3S/c1-15-11-13-17(14-12-15)28(26,27)24-20(18-9-5-6-10-19(18)23)21(24)22(25)16-7-3-2-4-8-16/h2-14,20-21H,1H3 |
| InChIKey | FMGFBRMSSVEZEI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|