C25H27FN4O2 — CID 118395458
tert-butyl 4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidine-1-carboxylate (PubChem CID 118395458) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is tert-butyl 4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118395458 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | tert-butyl 4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2ncc3ccc(-c4c[nH]c5cc(F)ccc45)cc32)CC1 |
| InChI | InChI=1S/C25H27FN4O2/c1-25(2,3)32-24(31)29-10-8-19(9-11-29)30-23-12-16(4-5-17(23)14-28-30)21-15-27-22-13-18(26)6-7-20(21)22/h4-7,12-15,19,27H,8-11H2,1-3H3 |
| InChIKey | CXDCZUFTADONRZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |