C22H21N3O3 — CID 11840058
N-[(Z)-1-(5-methylfuran-2-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]benzamide (PubChem CID 11840058) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(Z)-1-(5-methylfuran-2-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(5-methylfuran-2-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 11840058 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(Z)-1-(5-methylfuran-2-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)NCCc2ccccn2)o1 |
| InChI | InChI=1S/C22H21N3O3/c1-16-10-11-19(28-16)15-20(25-21(26)17-7-3-2-4-8-17)22(27)24-14-12-18-9-5-6-13-23-18/h2-11,13,15H,12,14H2,1H3,(H,24,27)(H,25,26)/b20-15- |
| InChIKey | YQDPUIYVRNAJMM-HKWRFOASSA-N |
| XLogP | 3.11 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|