C22H24N2O3 — CID 16736437
7-(3-methoxyphenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one (PubChem CID 16736437) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 7-(3-methoxyphenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one.
| Compound Name | 7-(3-methoxyphenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 16736437 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 7-(3-methoxyphenyl)-1-(5-pyridin-2-yl-1,3-oxazol-2-yl)heptan-1-one |
| SMILES | COc1cccc(CCCCCCC(=O)c2ncc(-c3ccccn3)o2)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-26-18-11-8-10-17(15-18)9-4-2-3-5-13-20(25)22-24-16-21(27-22)19-12-6-7-14-23-19/h6-8,10-12,14-16H,2-5,9,13H2,1H3 |
| InChIKey | NWUNIVMFVYNPEW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|