C20H23BrN2O3 — CID 118401645
2-[(2E)-2-[(Z)-3-bromoprop-1-enyl]penta-2,4-dienyl]-4-(oxolan-2-ylmethoxy)-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 118401645) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is 2-[(2E)-2-[(Z)-3-bromoprop-1-enyl]penta-2,4-dienyl]-4-(oxolan-2-ylmethoxy)-1H-pyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 2-[(2E)-2-[(Z)-3-bromoprop-1-enyl]penta-2,4-dienyl]-4-(oxolan-2-ylmethoxy)-1H-pyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 118401645 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[(2E)-2-[(Z)-3-bromoprop-1-enyl]penta-2,4-dienyl]-4-(oxolan-2-ylmethoxy)-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | C=C/C=C(\C=C/CBr)CN1Cc2ccnc(OCC3CCCO3)c2C1=O |
| InChI | InChI=1S/C20H23BrN2O3/c1-2-5-15(6-3-9-21)12-23-13-16-8-10-22-19(18(16)20(23)24)26-14-17-7-4-11-25-17/h2-3,5-6,8,10,17H,1,4,7,9,11-14H2/b6-3-,15-5+ |
| InChIKey | BEYLPWGTPDXSHZ-SHGZNFRFSA-N |
| XLogP | 3.66 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|