C18H22N2O4 — CID 166972445
1-(oxolan-2-ylmethoxy)-7-propan-2-yloxyisoquinoline-6-carboxamide (PubChem CID 166972445) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethoxy)-7-propan-2-yloxyisoquinoline-6-carboxamide.
| Compound Name | 1-(oxolan-2-ylmethoxy)-7-propan-2-yloxyisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 166972445 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(oxolan-2-ylmethoxy)-7-propan-2-yloxyisoquinoline-6-carboxamide |
| SMILES | CC(C)Oc1cc2c(OCC3CCCO3)nccc2cc1C(N)=O |
| InChI | InChI=1S/C18H22N2O4/c1-11(2)24-16-9-14-12(8-15(16)17(19)21)5-6-20-18(14)23-10-13-4-3-7-22-13/h5-6,8-9,11,13H,3-4,7,10H2,1-2H3,(H2,19,21) |
| InChIKey | QYELFTUQGKQHGW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |