C37H58N2O4 — CID 118403299
(2,5-diaminophenyl) 4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-hydroperoxybutanoate (PubChem CID 118403299) has the molecular formula C37H58N2O4 and a molecular weight of 594.88 g/mol. Its IUPAC name is (2,5-diaminophenyl) 4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-hydroperoxybutanoate.
| Compound Name | (2,5-diaminophenyl) 4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-hydroperoxybutanoate |
|---|---|
| PubChem CID | 118403299 |
| Molecular Formula | C37H58N2O4 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | (2,5-diaminophenyl) 4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-4-hydroperoxybutanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(C(CCC(=O)Oc5cc(N)ccc5N)OO)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C37H58N2O4/c1-23(2)7-6-8-24(3)29-12-13-30-28-11-9-26-21-25(17-19-36(26,4)31(28)18-20-37(29,30)5)33(43-41)15-16-35(40)42-34-22-27(38)10-14-32(34)39/h9-10,14,22-25,28-31,33,41H,6-8,11-13,15-21,38-39H2,1-5H3 |
| InChIKey | ITXAHAIBLNNOKM-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|