C30H48O4 — CID 118403985
methyl (1R,3aS,5bS,9R,10R,11aR)-9,10-dihydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate (PubChem CID 118403985) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is methyl (1R,3aS,5bS,9R,10R,11aR)-9,10-dihydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate.
| Compound Name | methyl (1R,3aS,5bS,9R,10R,11aR)-9,10-dihydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate |
|---|---|
| PubChem CID | 118403985 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | methyl (1R,3aS,5bS,9R,10R,11aR)-9,10-dihydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylate |
| SMILES | C=C(C)C1CC[C@]2(C(=O)OC)CCC3C(CCC4[C@@]3(C)CCC3C(C)(C)[C@@H](O)[C@H](O)C[C@@]34C)C12 |
| InChI | InChI=1S/C30H48O4/c1-17(2)18-10-14-30(26(33)34-7)15-11-20-19(24(18)30)8-9-23-28(20,5)13-12-22-27(3,4)25(32)21(31)16-29(22,23)6/h18-25,31-32H,1,8-16H2,2-7H3/t18?,19?,20?,21-,22?,23?,24?,25+,28+,29+,30+/m1/s1 |
| InChIKey | VWNICLODKZOLEZ-JTDAHBAYSA-N |
| XLogP | 5.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|