C18H14F2N2O2 — CID 118404782
3-[1-[4-(1,1-difluoroethyl)phenyl]pyrazol-3-yl]benzoic acid (PubChem CID 118404782) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-[1-[4-(1,1-difluoroethyl)phenyl]pyrazol-3-yl]benzoic acid.
| Compound Name | 3-[1-[4-(1,1-difluoroethyl)phenyl]pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 118404782 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-[1-[4-(1,1-difluoroethyl)phenyl]pyrazol-3-yl]benzoic acid |
| SMILES | CC(F)(F)c1ccc(-n2ccc(-c3cccc(C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-18(19,20)14-5-7-15(8-6-14)22-10-9-16(21-22)12-3-2-4-13(11-12)17(23)24/h2-11H,1H3,(H,23,24) |
| InChIKey | ODWOJQLLUVRVAK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |