C19H13F3N2O3 — CID 141222501
2-[2-methyl-5-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]phenyl]-2-oxoacetic acid (PubChem CID 141222501) has the molecular formula C19H13F3N2O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 2-[2-methyl-5-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]phenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-methyl-5-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 141222501 |
| Molecular Formula | C19H13F3N2O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-[2-methyl-5-[1-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]phenyl]-2-oxoacetic acid |
| SMILES | Cc1ccc(-c2ccn(-c3cccc(C(F)(F)F)c3)n2)cc1C(=O)C(=O)O |
| InChI | InChI=1S/C19H13F3N2O3/c1-11-5-6-12(9-15(11)17(25)18(26)27)16-7-8-24(23-16)14-4-2-3-13(10-14)19(20,21)22/h2-10H,1H3,(H,26,27) |
| InChIKey | BRZHWDRNLWPNEE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|