C14H10F3N2O3- — CID 7131608
2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetate (PubChem CID 7131608) has the molecular formula C14H10F3N2O3- and a molecular weight of 311.24 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetate.
| Compound Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 7131608 |
| Molecular Formula | C14H10F3N2O3- |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetate |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(C)c1C(=O)C(=O)[O-] |
| InChI | InChI=1S/C14H11F3N2O3/c1-7-11(12(20)13(21)22)8(2)19(18-7)10-5-3-4-9(6-10)14(15,16)17/h3-6H,1-2H3,(H,21,22)/p-1 |
| InChIKey | DIZUBEDMZQHUFF-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|