C18H18F3N3O4S — CID 42921507
2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide (PubChem CID 42921507) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide.
| Compound Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 42921507 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(C)c1C(=O)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H18F3N3O4S/c1-10-15(16(25)17(26)22-13-6-7-29(27,28)9-13)11(2)24(23-10)14-5-3-4-12(8-14)18(19,20)21/h3-5,8,13H,6-7,9H2,1-2H3,(H,22,26) |
| InChIKey | WWWWLCSLLIKJAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|