C20H17F3N4O4S — CID 27005890
2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-(3-sulfamoylphenyl)acetamide (PubChem CID 27005890) has the molecular formula C20H17F3N4O4S and a molecular weight of 466.44 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 27005890 |
| Molecular Formula | C20H17F3N4O4S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-(3-sulfamoylphenyl)acetamide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(C)c1C(=O)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H17F3N4O4S/c1-11-17(12(2)27(26-11)15-7-3-5-13(9-15)20(21,22)23)18(28)19(29)25-14-6-4-8-16(10-14)32(24,30)31/h3-10H,1-2H3,(H,25,29)(H2,24,30,31) |
| InChIKey | NWNHAOPGUWYMPF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|