C18H14Cl2N4O3S — CID 11840496
6-(2,5-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 11840496) has the molecular formula C18H14Cl2N4O3S and a molecular weight of 437.31 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2,5-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 11840496 |
| Molecular Formula | C18H14Cl2N4O3S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 6-(2,5-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1cc(-c2nnc3sc(-c4cc(Cl)ccc4Cl)nn23)cc(OC)c1OC |
| InChI | InChI=1S/C18H14Cl2N4O3S/c1-25-13-6-9(7-14(26-2)15(13)27-3)16-21-22-18-24(16)23-17(28-18)11-8-10(19)4-5-12(11)20/h4-8H,1-3H3 |
| InChIKey | SBINLIPSQLMGCA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |