C19H19N5OS — CID 11840621
N,N-dimethyl-4-[6-[(2-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline (PubChem CID 11840621) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is N,N-dimethyl-4-[6-[(2-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[6-[(2-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 11840621 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N,N-dimethyl-4-[6-[(2-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline |
| SMILES | Cc1ccccc1OCc1nn2c(-c3ccc(N(C)C)cc3)nnc2s1 |
| InChI | InChI=1S/C19H19N5OS/c1-13-6-4-5-7-16(13)25-12-17-22-24-18(20-21-19(24)26-17)14-8-10-15(11-9-14)23(2)3/h4-11H,12H2,1-3H3 |
| InChIKey | VBTOHPICBWXZDK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |