C20H21N5S — CID 35074450
4-[6-[(3,4-dimethylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-N,N-dimethylaniline (PubChem CID 35074450) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is 4-[6-[(3,4-dimethylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-[(3,4-dimethylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 35074450 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-[6-[(3,4-dimethylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(Cc2nn3c(-c4ccc(N(C)C)cc4)nnc3s2)cc1C |
| InChI | InChI=1S/C20H21N5S/c1-13-5-6-15(11-14(13)2)12-18-23-25-19(21-22-20(25)26-18)16-7-9-17(10-8-16)24(3)4/h5-11H,12H2,1-4H3 |
| InChIKey | IPCUQNZTDLEJLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |