C16H14N6O2S — CID 135542015
4-[3-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pyridine-3,5-diol (PubChem CID 135542015) has the molecular formula C16H14N6O2S and a molecular weight of 354.40 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pyridine-3,5-diol.
| Compound Name | 4-[3-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pyridine-3,5-diol |
|---|---|
| PubChem CID | 135542015 |
| Molecular Formula | C16H14N6O2S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[3-[4-(dimethylamino)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pyridine-3,5-diol |
| SMILES | CN(C)c1ccc(-c2nnc3sc(-c4c(O)cncc4O)nn23)cc1 |
| InChI | InChI=1S/C16H14N6O2S/c1-21(2)10-5-3-9(4-6-10)14-18-19-16-22(14)20-15(25-16)13-11(23)7-17-8-12(13)24/h3-8,23-24H,1-2H3 |
| InChIKey | DYATXSIXGDCIHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |