C20H21N5S — CID 40964761
N,N-dimethyl-4-[6-[(1S)-1-phenylpropyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline (PubChem CID 40964761) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[6-[(1S)-1-phenylpropyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[6-[(1S)-1-phenylpropyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 40964761 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N,N-dimethyl-4-[6-[(1S)-1-phenylpropyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]aniline |
| SMILES | CC[C@@H](c1ccccc1)c1nn2c(-c3ccc(N(C)C)cc3)nnc2s1 |
| InChI | InChI=1S/C20H21N5S/c1-4-17(14-8-6-5-7-9-14)19-23-25-18(21-22-20(25)26-19)15-10-12-16(13-11-15)24(2)3/h5-13,17H,4H2,1-3H3/t17-/m0/s1 |
| InChIKey | VHMOSIQIXLGWPY-KRWDZBQOSA-N |
| XLogP | 4.46 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |