C26H32N2O2 — CID 118406723
(R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-phenyl-2,3-dihydro-1H-quinolin-4-yl)methanol (PubChem CID 118406723) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is (R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-phenyl-2,3-dihydro-1H-quinolin-4-yl)methanol.
| Compound Name | (R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-phenyl-2,3-dihydro-1H-quinolin-4-yl)methanol |
|---|---|
| PubChem CID | 118406723 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-4-phenyl-2,3-dihydro-1H-quinolin-4-yl)methanol |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@H](O)C1(c2ccccc2)CCNc2ccc(OC)cc21 |
| InChI | InChI=1S/C26H32N2O2/c1-3-18-17-28-14-11-19(18)15-24(28)25(29)26(20-7-5-4-6-8-20)12-13-27-23-10-9-21(30-2)16-22(23)26/h3-10,16,18-19,24-25,27,29H,1,11-15,17H2,2H3/t18?,19?,24-,25-,26?/m0/s1 |
| InChIKey | ZCICTYIRJIHLQA-HRZMPFBOSA-N |
| XLogP | 4.05 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|