C15H15N3O3 — CID 118410954
methyl 6-[(3-methylphenyl)methylcarbamoyl]pyrimidine-4-carboxylate (PubChem CID 118410954) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 6-[(3-methylphenyl)methylcarbamoyl]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-[(3-methylphenyl)methylcarbamoyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 118410954 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 6-[(3-methylphenyl)methylcarbamoyl]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)NCc2cccc(C)c2)ncn1 |
| InChI | InChI=1S/C15H15N3O3/c1-10-4-3-5-11(6-10)8-16-14(19)12-7-13(15(20)21-2)18-9-17-12/h3-7,9H,8H2,1-2H3,(H,16,19) |
| InChIKey | APVKLCOSYNNYCL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |