C22H22N4O2 — CID 5289109
4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 5289109) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 5289109 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cccc(CNC(=O)c2cc(C(=O)NCc3cccc(C)c3)ncn2)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-15-5-3-7-17(9-15)12-23-21(27)19-11-20(26-14-25-19)22(28)24-13-18-8-4-6-16(2)10-18/h3-11,14H,12-13H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | GTBUZLPQANSGGE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |